C22H23NO5 — CID 7672790
pentyl (2S)-2-[4-(1,3-dioxoisoindol-2-yl)phenoxy]propanoate (PubChem CID 7672790) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is pentyl (2S)-2-[4-(1,3-dioxoisoindol-2-yl)phenoxy]propanoate.
| Compound Name | pentyl (2S)-2-[4-(1,3-dioxoisoindol-2-yl)phenoxy]propanoate |
|---|---|
| PubChem CID | 7672790 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | pentyl (2S)-2-[4-(1,3-dioxoisoindol-2-yl)phenoxy]propanoate |
| SMILES | CCCCCOC(=O)[C@H](C)Oc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-3-4-7-14-27-22(26)15(2)28-17-12-10-16(11-13-17)23-20(24)18-8-5-6-9-19(18)21(23)25/h5-6,8-13,15H,3-4,7,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | JYPWHWNYJQOZIK-HNNXBMFYSA-N |
| XLogP | 3.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|