C37H46O8 — CID 70399411
[4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenoxy]carbonylphenyl] 2-octoxybenzoate (PubChem CID 70399411) has the molecular formula C37H46O8 and a molecular weight of 618.77 g/mol. Its IUPAC name is [4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenoxy]carbonylphenyl] 2-octoxybenzoate.
| Compound Name | [4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenoxy]carbonylphenyl] 2-octoxybenzoate |
|---|---|
| PubChem CID | 70399411 |
| Molecular Formula | C37H46O8 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | [4-[4-(1-hexoxy-1-oxopropan-2-yl)oxyphenoxy]carbonylphenyl] 2-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Oc1ccc(C(=O)Oc2ccc(OC(C)C(=O)OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C37H46O8/c1-4-6-8-10-11-15-26-41-34-17-13-12-16-33(34)37(40)45-31-20-18-29(19-21-31)36(39)44-32-24-22-30(23-25-32)43-28(3)35(38)42-27-14-9-7-5-2/h12-13,16-25,28H,4-11,14-15,26-27H2,1-3H3 |
| InChIKey | UXKXVHLXMBBFFN-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|