C14H17F3O3 — CID 102301970
butyl (2R)-2-[4-(trifluoromethyl)phenoxy]propanoate (PubChem CID 102301970) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is butyl (2R)-2-[4-(trifluoromethyl)phenoxy]propanoate.
| Compound Name | butyl (2R)-2-[4-(trifluoromethyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 102301970 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | butyl (2R)-2-[4-(trifluoromethyl)phenoxy]propanoate |
| SMILES | CCCCOC(=O)[C@@H](C)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O3/c1-3-4-9-19-13(18)10(2)20-12-7-5-11(6-8-12)14(15,16)17/h5-8,10H,3-4,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | JRKHIAJFLZZJNJ-SNVBAGLBSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|