C28H27F3O5 — CID 70590063
[2-(4-tert-butylphenyl)-2-oxoethyl] 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 70590063) has the molecular formula C28H27F3O5 and a molecular weight of 500.51 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 70590063 |
| Molecular Formula | C28H27F3O5 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)OCC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H27F3O5/c1-18(26(33)34-17-25(32)19-5-7-20(8-6-19)27(2,3)4)35-22-13-15-24(16-14-22)36-23-11-9-21(10-12-23)28(29,30)31/h5-16,18H,17H2,1-4H3 |
| InChIKey | KGGZOIYCLQVYGQ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |