C16H13F3O3S — CID 20555453
2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanethioic S-acid (PubChem CID 20555453) has the molecular formula C16H13F3O3S and a molecular weight of 342.34 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanethioic S-acid.
| Compound Name | 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanethioic S-acid |
|---|---|
| PubChem CID | 20555453 |
| Molecular Formula | C16H13F3O3S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanethioic S-acid |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)S |
| InChI | InChI=1S/C16H13F3O3S/c1-10(15(20)23)21-12-6-8-14(9-7-12)22-13-4-2-11(3-5-13)16(17,18)19/h2-10H,1H3,(H,20,23) |
| InChIKey | IOAQAKARWQLYFI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|