C22H22F3NO5 — CID 12852253
(cyclopentylideneamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 12852253) has the molecular formula C22H22F3NO5 and a molecular weight of 437.41 g/mol. Its IUPAC name is (cyclopentylideneamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
| Compound Name | (cyclopentylideneamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 12852253 |
| Molecular Formula | C22H22F3NO5 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (cyclopentylideneamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)OCON=C1CCCC1 |
| InChI | InChI=1S/C22H22F3NO5/c1-15(21(27)28-14-29-26-17-4-2-3-5-17)30-18-10-12-20(13-11-18)31-19-8-6-16(7-9-19)22(23,24)25/h6-13,15H,2-5,14H2,1H3 |
| InChIKey | NEUNDXVQHOYIPO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|