C19H17F3O5 — CID 13472766
methyl (4R)-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate (PubChem CID 13472766) has the molecular formula C19H17F3O5 and a molecular weight of 382.33 g/mol. Its IUPAC name is methyl (4R)-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate.
| Compound Name | methyl (4R)-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate |
|---|---|
| PubChem CID | 13472766 |
| Molecular Formula | C19H17F3O5 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | methyl (4R)-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate |
| SMILES | COC(=O)CC(=O)[C@@H](C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H17F3O5/c1-12(17(23)11-18(24)25-2)26-14-7-9-16(10-8-14)27-15-5-3-13(4-6-15)19(20,21)22/h3-10,12H,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | AGEOAKGINNQBCR-GFCCVEGCSA-N |
| XLogP | 4.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|