C17H14F3KN2O3S2 — CID 139682382
potassium N-[2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoylamino]carbamodithioate (PubChem CID 139682382) has the molecular formula C17H14F3KN2O3S2 and a molecular weight of 454.54 g/mol. Its IUPAC name is potassium N-[2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoylamino]carbamodithioate.
| Compound Name | potassium N-[2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoylamino]carbamodithioate |
|---|---|
| PubChem CID | 139682382 |
| Molecular Formula | C17H14F3KN2O3S2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | potassium N-[2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoylamino]carbamodithioate |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)NNC(=S)[S-].[K+] |
| InChI | InChI=1S/C17H15F3N2O3S2.K/c1-10(15(23)21-22-16(26)27)24-12-6-8-14(9-7-12)25-13-4-2-11(3-5-13)17(18,19)20;/h2-10H,1H3,(H,21,23)(H2,22,26,27);/q;+1/p-1 |
| InChIKey | QSFSRMOWAQJJNF-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|