C21H17F3N2O3 — CID 27813982
N'-[(2S)-2-naphthalen-2-yloxypropanoyl]-4-(trifluoromethyl)benzohydrazide (PubChem CID 27813982) has the molecular formula C21H17F3N2O3 and a molecular weight of 402.37 g/mol. Its IUPAC name is N'-[(2S)-2-naphthalen-2-yloxypropanoyl]-4-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[(2S)-2-naphthalen-2-yloxypropanoyl]-4-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 27813982 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N'-[(2S)-2-naphthalen-2-yloxypropanoyl]-4-(trifluoromethyl)benzohydrazide |
| SMILES | C[C@H](Oc1ccc2ccccc2c1)C(=O)NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F3N2O3/c1-13(29-18-11-8-14-4-2-3-5-16(14)12-18)19(27)25-26-20(28)15-6-9-17(10-7-15)21(22,23)24/h2-13H,1H3,(H,25,27)(H,26,28)/t13-/m0/s1 |
| InChIKey | OJMJNTBLUUPFMY-ZDUSSCGKSA-N |
| XLogP | 4.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|