C18H14Cl3F3N2O3 — CID 54337404
N-(2,2,2-trichloroethylideneamino)-2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanamide (PubChem CID 54337404) has the molecular formula C18H14Cl3F3N2O3 and a molecular weight of 469.67 g/mol. Its IUPAC name is N-(2,2,2-trichloroethylideneamino)-2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanamide.
| Compound Name | N-(2,2,2-trichloroethylideneamino)-2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanamide |
|---|---|
| PubChem CID | 54337404 |
| Molecular Formula | C18H14Cl3F3N2O3 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | N-(2,2,2-trichloroethylideneamino)-2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanamide |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)NN=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H14Cl3F3N2O3/c1-11(16(27)26-25-10-17(19,20)21)28-13-6-8-15(9-7-13)29-14-4-2-12(3-5-14)18(22,23)24/h2-11H,1H3,(H,26,27) |
| InChIKey | TWLWFDSVLFTZDZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|