C19H17ClF3NO5 — CID 13325088
[(2-chloroacetyl)amino]methyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 13325088) has the molecular formula C19H17ClF3NO5 and a molecular weight of 431.79 g/mol. Its IUPAC name is [(2-chloroacetyl)amino]methyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
| Compound Name | [(2-chloroacetyl)amino]methyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 13325088 |
| Molecular Formula | C19H17ClF3NO5 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | [(2-chloroacetyl)amino]methyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)OCNC(=O)CCl |
| InChI | InChI=1S/C19H17ClF3NO5/c1-12(18(26)27-11-24-17(25)10-20)28-14-6-8-16(9-7-14)29-15-4-2-13(3-5-15)19(21,22)23/h2-9,12H,10-11H2,1H3,(H,24,25) |
| InChIKey | ZWEMYWCJRPEBJY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|