C24H26F3NO5 — CID 57017960
(cyclohepten-1-ylamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 57017960) has the molecular formula C24H26F3NO5 and a molecular weight of 465.47 g/mol. Its IUPAC name is (cyclohepten-1-ylamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
| Compound Name | (cyclohepten-1-ylamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 57017960 |
| Molecular Formula | C24H26F3NO5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (cyclohepten-1-ylamino)oxymethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)OCONC1=CCCCCC1 |
| InChI | InChI=1S/C24H26F3NO5/c1-17(23(29)30-16-31-28-19-6-4-2-3-5-7-19)32-20-12-14-22(15-13-20)33-21-10-8-18(9-11-21)24(25,26)27/h6,8-15,17,28H,2-5,7,16H2,1H3 |
| InChIKey | DTTSDJOMGZLGCV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|