C22H21F3O6 — CID 54009826
ethyl (4R)-2-acetyl-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate (PubChem CID 54009826) has the molecular formula C22H21F3O6 and a molecular weight of 438.40 g/mol. Its IUPAC name is ethyl (4R)-2-acetyl-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate.
| Compound Name | ethyl (4R)-2-acetyl-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate |
|---|---|
| PubChem CID | 54009826 |
| Molecular Formula | C22H21F3O6 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | ethyl (4R)-2-acetyl-3-oxo-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoate |
| SMILES | CCOC(=O)C(C(C)=O)C(=O)[C@@H](C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H21F3O6/c1-4-29-21(28)19(13(2)26)20(27)14(3)30-16-9-11-18(12-10-16)31-17-7-5-15(6-8-17)22(23,24)25/h5-12,14,19H,4H2,1-3H3/t14-,19?/m1/s1 |
| InChIKey | KRNHJCABAOFEOP-MJTSIZKDSA-N |
| XLogP | 4.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|