C18H17F3O4 — CID 12906025
2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoic acid (PubChem CID 12906025) has the molecular formula C18H17F3O4 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoic acid.
| Compound Name | 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 12906025 |
| Molecular Formula | C18H17F3O4 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pentanoic acid |
| SMILES | CCCC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C18H17F3O4/c1-2-3-16(17(22)23)25-15-10-8-14(9-11-15)24-13-6-4-12(5-7-13)18(19,20)21/h4-11,16H,2-3H2,1H3,(H,22,23) |
| InChIKey | OIJLDDLNXWUUDY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |