C15H13F3O3S — CID 59215026
4-thiophen-2-yl-2-[4-(trifluoromethyl)phenoxy]butanoic acid (PubChem CID 59215026) has the molecular formula C15H13F3O3S and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-thiophen-2-yl-2-[4-(trifluoromethyl)phenoxy]butanoic acid.
| Compound Name | 4-thiophen-2-yl-2-[4-(trifluoromethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 59215026 |
| Molecular Formula | C15H13F3O3S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-thiophen-2-yl-2-[4-(trifluoromethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)C(CCc1cccs1)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3O3S/c16-15(17,18)10-3-5-11(6-4-10)21-13(14(19)20)8-7-12-2-1-9-22-12/h1-6,9,13H,7-8H2,(H,19,20) |
| InChIKey | MDOBOOTWZWIJOC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |