2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid

C28H18F6O4 — CID 91671383

IUPAC2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid
SMILESO=C(O)C(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1
InChIInChI=1S/C28H18F6O4/c29-27(30,31)21-9-1-17(2-10-21)19-5-13-23(14-6-19)37-26(25(35)36)38-24-15-7-20(8-16-24)18-3-11-22(12-4-18)28(32,33)34/h1-16,26H,(H,35,36)
InChIKeyFSUBBMAXGISASM-UHFFFAOYSA-N
MW532.44 g/mol
LogP7.93
Rot. Bonds7

About 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid

2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid (PubChem CID 91671383) has the molecular formula C28H18F6O4 and a molecular weight of 532.44 g/mol. Its IUPAC name is 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid.

Molecular Properties

Compound Name2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid
PubChem CID91671383
Molecular FormulaC28H18F6O4
Molecular Weight532.44 g/mol
Exact Mass532.11
IUPAC Name2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid
SMILESO=C(O)C(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1
InChIInChI=1S/C28H18F6O4/c29-27(30,31)21-9-1-17(2-10-21)19-5-13-23(14-6-19)37-26(25(35)36)38-24-15-7-20(8-16-24)18-3-11-22(12-4-18)28(32,33)34/h1-16,26H,(H,35,36)
InChIKeyFSUBBMAXGISASM-UHFFFAOYSA-N
XLogP7.93
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms38
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500532.44
LogP ≤ 57.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid?
The IUPAC name of 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid (CID 91671383) is 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid.
What is the SMILES notation for 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid?
The canonical SMILES for 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid is O=C(O)C(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid?
The InChIKey is FSUBBMAXGISASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18F6O4/c29-27(30,31)21-9-1-17(2-10-21)19-5-13-23(14-6-19)37-26(25(35)36)38-24-15-7-20(8-16-24)18-3-11-22(12-4-18)28(32,33)34/h1-16,26H,(H,35,36).
What are the key properties of 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid?
2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid has a molecular weight of 532.44 g/mol, XLogP of 7.93, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid is sourced from PubChem (CID 91671383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).