C28H18F6O4 — CID 91671383
2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid (PubChem CID 91671383) has the molecular formula C28H18F6O4 and a molecular weight of 532.44 g/mol. Its IUPAC name is 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid.
| Compound Name | 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 91671383 |
| Molecular Formula | C28H18F6O4 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 2,2-bis[4-[4-(trifluoromethyl)phenyl]phenoxy]acetic acid |
| SMILES | O=C(O)C(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H18F6O4/c29-27(30,31)21-9-1-17(2-10-21)19-5-13-23(14-6-19)37-26(25(35)36)38-24-15-7-20(8-16-24)18-3-11-22(12-4-18)28(32,33)34/h1-16,26H,(H,35,36) |
| InChIKey | FSUBBMAXGISASM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|