C16H10F6NaO3 — CID 87618291
CID 87618291 (PubChem CID 87618291) has the molecular formula C16H10F6NaO3 and a molecular weight of 387.23 g/mol.
| Compound Name | CID 87618291 |
|---|---|
| PubChem CID | 87618291 |
| Molecular Formula | C16H10F6NaO3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | — |
| SMILES | O=C(O)C(Oc1ccc(C(F)(F)F)cc1)c1cccc(C(F)(F)F)c1.[Na] |
| InChI | InChI=1S/C16H10F6O3.Na/c17-15(18,19)10-4-6-12(7-5-10)25-13(14(23)24)9-2-1-3-11(8-9)16(20,21)22;/h1-8,13H,(H,23,24); |
| InChIKey | SXTRIYZSXFHQPC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |