C16H9ClF6O2 — CID 59713024
2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl chloride (PubChem CID 59713024) has the molecular formula C16H9ClF6O2 and a molecular weight of 382.69 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl chloride.
| Compound Name | 2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl chloride |
|---|---|
| PubChem CID | 59713024 |
| Molecular Formula | C16H9ClF6O2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl chloride |
| SMILES | O=C(Cl)C(Oc1ccc(C(F)(F)F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H9ClF6O2/c17-14(24)13(9-2-1-3-11(8-9)16(21,22)23)25-12-6-4-10(5-7-12)15(18,19)20/h1-8,13H |
| InChIKey | XJEVBVCNHRISEY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|