C17H9F6NO2 — CID 59713010
2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl cyanide (PubChem CID 59713010) has the molecular formula C17H9F6NO2 and a molecular weight of 373.25 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl cyanide.
| Compound Name | 2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl cyanide |
|---|---|
| PubChem CID | 59713010 |
| Molecular Formula | C17H9F6NO2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenoxy]-2-[3-(trifluoromethyl)phenyl]acetyl cyanide |
| SMILES | N#CC(=O)C(Oc1ccc(C(F)(F)F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F6NO2/c18-16(19,20)11-4-6-13(7-5-11)26-15(14(25)9-24)10-2-1-3-12(8-10)17(21,22)23/h1-8,15H |
| InChIKey | ZUZCZSTZSFNXGW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|