C21H14F6N2OS2 — CID 151282464
[3-oxo-5-thiocyanato-2,4-bis[3-(trifluoromethyl)phenyl]pentyl] thiocyanate (PubChem CID 151282464) has the molecular formula C21H14F6N2OS2 and a molecular weight of 488.48 g/mol. Its IUPAC name is [3-oxo-5-thiocyanato-2,4-bis[3-(trifluoromethyl)phenyl]pentyl] thiocyanate.
| Compound Name | [3-oxo-5-thiocyanato-2,4-bis[3-(trifluoromethyl)phenyl]pentyl] thiocyanate |
|---|---|
| PubChem CID | 151282464 |
| Molecular Formula | C21H14F6N2OS2 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | [3-oxo-5-thiocyanato-2,4-bis[3-(trifluoromethyl)phenyl]pentyl] thiocyanate |
| SMILES | N#CSCC(C(=O)C(CSC#N)c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F6N2OS2/c22-20(23,24)15-5-1-3-13(7-15)17(9-31-11-28)19(30)18(10-32-12-29)14-4-2-6-16(8-14)21(25,26)27/h1-8,17-18H,9-10H2 |
| InChIKey | NYRREMPDKWGFDD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|