C14H14F3NO2 — CID 102590069
tert-butyl 2-cyano-2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 102590069) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | tert-butyl 2-cyano-2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 102590069 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl 2-cyano-2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(C#N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NO2/c1-13(2,3)20-12(19)11(8-18)9-5-4-6-10(7-9)14(15,16)17/h4-7,11H,1-3H3 |
| InChIKey | GRHAWAPQXWBEKH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |