C15H10F3NO2 — CID 114820964
3-(5-methylfuran-3-yl)-3-oxo-2-[3-(trifluoromethyl)phenyl]propanenitrile (PubChem CID 114820964) has the molecular formula C15H10F3NO2 and a molecular weight of 293.24 g/mol. Its IUPAC name is 3-(5-methylfuran-3-yl)-3-oxo-2-[3-(trifluoromethyl)phenyl]propanenitrile.
| Compound Name | 3-(5-methylfuran-3-yl)-3-oxo-2-[3-(trifluoromethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 114820964 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-(5-methylfuran-3-yl)-3-oxo-2-[3-(trifluoromethyl)phenyl]propanenitrile |
| SMILES | Cc1cc(C(=O)C(C#N)c2cccc(C(F)(F)F)c2)co1 |
| InChI | InChI=1S/C15H10F3NO2/c1-9-5-11(8-21-9)14(20)13(7-19)10-3-2-4-12(6-10)15(16,17)18/h2-6,8,13H,1H3 |
| InChIKey | HRDBPZCIJCFCNJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |