C13H15F3O3 — CID 114282426
4-methyl-2-[4-(trifluoromethyl)phenoxy]pentanoic acid (PubChem CID 114282426) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is 4-methyl-2-[4-(trifluoromethyl)phenoxy]pentanoic acid.
| Compound Name | 4-methyl-2-[4-(trifluoromethyl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 114282426 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-methyl-2-[4-(trifluoromethyl)phenoxy]pentanoic acid |
| SMILES | CC(C)CC(Oc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C13H15F3O3/c1-8(2)7-11(12(17)18)19-10-5-3-9(4-6-10)13(14,15)16/h3-6,8,11H,7H2,1-2H3,(H,17,18) |
| InChIKey | SHXMBMQQTAMILK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |