C21H22F3NO4 — CID 87727879
2-[4-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid (PubChem CID 87727879) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is 2-[4-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid.
| Compound Name | 2-[4-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 87727879 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[4-[C-ethyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenoxy]butanoic acid |
| SMILES | CCC(=NOCc1ccc(C(F)(F)F)cc1)c1ccc(OC(CC)C(=O)O)cc1 |
| InChI | InChI=1S/C21H22F3NO4/c1-3-18(15-7-11-17(12-8-15)29-19(4-2)20(26)27)25-28-13-14-5-9-16(10-6-14)21(22,23)24/h5-12,19H,3-4,13H2,1-2H3,(H,26,27) |
| InChIKey | ITVFAXNNNZNBPM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|