C19H14F9NO — CID 59021079
(E)-1-[2,4-bis(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]propan-1-imine (PubChem CID 59021079) has the molecular formula C19H14F9NO and a molecular weight of 443.31 g/mol. Its IUPAC name is (E)-1-[2,4-bis(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]propan-1-imine.
| Compound Name | (E)-1-[2,4-bis(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]propan-1-imine |
|---|---|
| PubChem CID | 59021079 |
| Molecular Formula | C19H14F9NO |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (E)-1-[2,4-bis(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]propan-1-imine |
| SMILES | CC/C(=N\OCc1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F9NO/c1-2-16(29-30-10-11-3-5-12(6-4-11)17(20,21)22)14-8-7-13(18(23,24)25)9-15(14)19(26,27)28/h3-9H,2,10H2,1H3/b29-16+ |
| InChIKey | DKPAQBQLIHNKIQ-MUFRIFMGSA-N |
| XLogP | 7.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|