C23H20ClF3N2O3S — CID 172952844
CID 172952844 (PubChem CID 172952844) has the molecular formula C23H20ClF3N2O3S and a molecular weight of 496.94 g/mol.
| Compound Name | CID 172952844 |
|---|---|
| PubChem CID | 172952844 |
| Molecular Formula | C23H20ClF3N2O3S |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | — |
| SMILES | CC/C(=N\OCc1ccc(-c2ccccc2)cc1)c1cc(Cl)ccc1C(F)(F)F.N=S(=O)=O |
| InChI | InChI=1S/C23H19ClF3NO.HNO2S/c1-2-22(20-14-19(24)12-13-21(20)23(25,26)27)28-29-15-16-8-10-18(11-9-16)17-6-4-3-5-7-17;1-4(2)3/h3-14H,2,15H2,1H3;1H/b28-22+; |
| InChIKey | OAYNVLNPUZLEBV-GVWDPOEBSA-N |
| XLogP | 6.98 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|