C10H11F3O3S — CID 63073638
4,4,4-trifluoro-3-(2-thiophen-2-ylethoxy)butanoic acid (PubChem CID 63073638) has the molecular formula C10H11F3O3S and a molecular weight of 268.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(2-thiophen-2-ylethoxy)butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(2-thiophen-2-ylethoxy)butanoic acid |
|---|---|
| PubChem CID | 63073638 |
| Molecular Formula | C10H11F3O3S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4,4,4-trifluoro-3-(2-thiophen-2-ylethoxy)butanoic acid |
| SMILES | O=C(O)CC(OCCc1cccs1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3O3S/c11-10(12,13)8(6-9(14)15)16-4-3-7-2-1-5-17-7/h1-2,5,8H,3-4,6H2,(H,14,15) |
| InChIKey | CBVDLXFDWTYDOH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |