C20H18O3S — CID 59214928
(2S)-4-phenyl-2-(4-thiophen-3-ylphenoxy)butanoic acid (PubChem CID 59214928) has the molecular formula C20H18O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is (2S)-4-phenyl-2-(4-thiophen-3-ylphenoxy)butanoic acid.
| Compound Name | (2S)-4-phenyl-2-(4-thiophen-3-ylphenoxy)butanoic acid |
|---|---|
| PubChem CID | 59214928 |
| Molecular Formula | C20H18O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2S)-4-phenyl-2-(4-thiophen-3-ylphenoxy)butanoic acid |
| SMILES | O=C(O)[C@H](CCc1ccccc1)Oc1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C20H18O3S/c21-20(22)19(11-6-15-4-2-1-3-5-15)23-18-9-7-16(8-10-18)17-12-13-24-14-17/h1-5,7-10,12-14,19H,6,11H2,(H,21,22)/t19-/m0/s1 |
| InChIKey | XQCOOACHZUJICK-IBGZPJMESA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |