C21H23F3O4 — CID 19878783
2-(4-methylphenoxy)-7-[3-(trifluoromethyl)phenoxy]heptanoic acid (PubChem CID 19878783) has the molecular formula C21H23F3O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-7-[3-(trifluoromethyl)phenoxy]heptanoic acid.
| Compound Name | 2-(4-methylphenoxy)-7-[3-(trifluoromethyl)phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 19878783 |
| Molecular Formula | C21H23F3O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-(4-methylphenoxy)-7-[3-(trifluoromethyl)phenoxy]heptanoic acid |
| SMILES | Cc1ccc(OC(CCCCCOc2cccc(C(F)(F)F)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H23F3O4/c1-15-9-11-17(12-10-15)28-19(20(25)26)8-3-2-4-13-27-18-7-5-6-16(14-18)21(22,23)24/h5-7,9-12,14,19H,2-4,8,13H2,1H3,(H,25,26) |
| InChIKey | JFUIVBPDYULEDQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|