C21H25ClO4 — CID 19878843
8-(4-chlorophenoxy)-2-(4-methylphenoxy)octanoic acid (PubChem CID 19878843) has the molecular formula C21H25ClO4 and a molecular weight of 376.88 g/mol. Its IUPAC name is 8-(4-chlorophenoxy)-2-(4-methylphenoxy)octanoic acid.
| Compound Name | 8-(4-chlorophenoxy)-2-(4-methylphenoxy)octanoic acid |
|---|---|
| PubChem CID | 19878843 |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 8-(4-chlorophenoxy)-2-(4-methylphenoxy)octanoic acid |
| SMILES | Cc1ccc(OC(CCCCCCOc2ccc(Cl)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H25ClO4/c1-16-7-11-19(12-8-16)26-20(21(23)24)6-4-2-3-5-15-25-18-13-9-17(22)10-14-18/h7-14,20H,2-6,15H2,1H3,(H,23,24) |
| InChIKey | PANREXLNLFBXAL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|