C19H21ClO4 — CID 19878772
6-(4-chlorophenoxy)-2-(4-methylphenoxy)hexanoic acid (PubChem CID 19878772) has the molecular formula C19H21ClO4 and a molecular weight of 348.83 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-2-(4-methylphenoxy)hexanoic acid.
| Compound Name | 6-(4-chlorophenoxy)-2-(4-methylphenoxy)hexanoic acid |
|---|---|
| PubChem CID | 19878772 |
| Molecular Formula | C19H21ClO4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-(4-chlorophenoxy)-2-(4-methylphenoxy)hexanoic acid |
| SMILES | Cc1ccc(OC(CCCCOc2ccc(Cl)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H21ClO4/c1-14-5-9-17(10-6-14)24-18(19(21)22)4-2-3-13-23-16-11-7-15(20)8-12-16/h5-12,18H,2-4,13H2,1H3,(H,21,22) |
| InChIKey | LXVRBJBNRAMCCD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|