C17H16F3NO3S — CID 55359259
[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-thiophen-2-ylpropanoate (PubChem CID 55359259) has the molecular formula C17H16F3NO3S and a molecular weight of 371.38 g/mol. Its IUPAC name is [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-thiophen-2-ylpropanoate.
| Compound Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 55359259 |
| Molecular Formula | C17H16F3NO3S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-thiophen-2-ylpropanoate |
| SMILES | CC(OC(=O)CCc1cccs1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO3S/c1-11(24-15(22)9-8-14-3-2-10-25-14)16(23)21-13-6-4-12(5-7-13)17(18,19)20/h2-7,10-11H,8-9H2,1H3,(H,21,23) |
| InChIKey | XXTGXCKRZNBXOW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |