C17H17F3N4O3 — CID 55701334
[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55701334) has the molecular formula C17H17F3N4O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55701334 |
| Molecular Formula | C17H17F3N4O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | CC(OC(=O)CCNc1ncccn1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N4O3/c1-11(27-14(25)7-10-23-16-21-8-2-9-22-16)15(26)24-13-5-3-12(4-6-13)17(18,19)20/h2-6,8-9,11H,7,10H2,1H3,(H,24,26)(H,21,22,23) |
| InChIKey | WEPROIUGOZMGQY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |