C17H20F3NO3 — CID 7722404
[(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-cyclopentylacetate (PubChem CID 7722404) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-cyclopentylacetate.
| Compound Name | [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 7722404 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-cyclopentylacetate |
| SMILES | C[C@H](OC(=O)CC1CCCC1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F3NO3/c1-11(24-15(22)10-12-4-2-3-5-12)16(23)21-14-8-6-13(7-9-14)17(18,19)20/h6-9,11-12H,2-5,10H2,1H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | NWHZVSMGAGNZPB-NSHDSACASA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |