C19H25N5O5S — CID 55701436
[1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55701436) has the molecular formula C19H25N5O5S and a molecular weight of 435.51 g/mol. Its IUPAC name is [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55701436 |
| Molecular Formula | C19H25N5O5S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)C(C)OC(=O)CCNc2ncccn2)cc1 |
| InChI | InChI=1S/C19H25N5O5S/c1-13(2)24-30(27,28)16-7-5-15(6-8-16)23-18(26)14(3)29-17(25)9-12-22-19-20-10-4-11-21-19/h4-8,10-11,13-14,24H,9,12H2,1-3H3,(H,23,26)(H,20,21,22) |
| InChIKey | VXGYJRWGWIUZLW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |