C16H14F3NO3S — CID 55418017
[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-thiophen-2-ylacetate (PubChem CID 55418017) has the molecular formula C16H14F3NO3S and a molecular weight of 357.35 g/mol. Its IUPAC name is [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-thiophen-2-ylacetate.
| Compound Name | [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 55418017 |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl] 2-thiophen-2-ylacetate |
| SMILES | CC(OC(=O)Cc1cccs1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H14F3NO3S/c1-10(23-14(21)9-11-5-4-8-24-11)15(22)20-13-7-3-2-6-12(13)16(17,18)19/h2-8,10H,9H2,1H3,(H,20,22) |
| InChIKey | FXBAUJBGYMVRSA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |