C17H19NO4S2 — CID 8506121
[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate (PubChem CID 8506121) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate.
| Compound Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
|---|---|
| PubChem CID | 8506121 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
| SMILES | COc1ccccc1NC(=O)[C@H](C)OC(=O)CSCc1cccs1 |
| InChI | InChI=1S/C17H19NO4S2/c1-12(17(20)18-14-7-3-4-8-15(14)21-2)22-16(19)11-23-10-13-6-5-9-24-13/h3-9,12H,10-11H2,1-2H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | SKKRNVUSVOZDKV-LBPRGKRZSA-N |
| XLogP | 3.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |