C16H21N2O2S+ — CID 8516915
[(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8516915) has the molecular formula C16H21N2O2S+ and a molecular weight of 305.42 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8516915 |
| Molecular Formula | C16H21N2O2S+ |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [(2R)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 |
| InChI | InChI=1S/C16H20N2O2S/c1-12(18(2)11-13-7-6-10-21-13)16(19)17-14-8-4-5-9-15(14)20-3/h4-10,12H,11H2,1-3H3,(H,17,19)/p+1/t12-/m1/s1 |
| InChIKey | GSARPXXPYGFPQI-GFCCVEGCSA-O |
| XLogP | 1.80 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |