C22H25N2O2S+ — CID 8516835
[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8516835) has the molecular formula C22H25N2O2S+ and a molecular weight of 381.52 g/mol. Its IUPAC name is [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8516835 |
| Molecular Formula | C22H25N2O2S+ |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CCOc1ccccc1NC(=O)[C@H](c1ccccc1)[NH+](C)Cc1cccs1 |
| InChI | InChI=1S/C22H24N2O2S/c1-3-26-20-14-8-7-13-19(20)23-22(25)21(17-10-5-4-6-11-17)24(2)16-18-12-9-15-27-18/h4-15,21H,3,16H2,1-2H3,(H,23,25)/p+1/t21-/m0/s1 |
| InChIKey | ZJTFHZSLCHKONV-NRFANRHFSA-O |
| XLogP | 3.54 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |