C20H20FN2OS+ — CID 8516849
[(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8516849) has the molecular formula C20H20FN2OS+ and a molecular weight of 355.46 g/mol. Its IUPAC name is [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8516849 |
| Molecular Formula | C20H20FN2OS+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | C[NH+](Cc1cccs1)[C@@H](C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H19FN2OS/c1-23(14-18-8-5-13-25-18)19(15-6-3-2-4-7-15)20(24)22-17-11-9-16(21)10-12-17/h2-13,19H,14H2,1H3,(H,22,24)/p+1/t19-/m1/s1 |
| InChIKey | WQXLGAJVIGFCLU-LJQANCHMSA-O |
| XLogP | 3.28 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |