C25H21FN2OS — CID 9051153
(2R)-N-(4-fluorophenyl)-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide (PubChem CID 9051153) has the molecular formula C25H21FN2OS and a molecular weight of 416.52 g/mol. Its IUPAC name is (2R)-N-(4-fluorophenyl)-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide.
| Compound Name | (2R)-N-(4-fluorophenyl)-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9051153 |
| Molecular Formula | C25H21FN2OS |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (2R)-N-(4-fluorophenyl)-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@H](N[C@@H](c1ccccc1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C25H21FN2OS/c26-20-13-15-21(16-14-20)27-25(29)24(19-10-5-2-6-11-19)28-23(22-12-7-17-30-22)18-8-3-1-4-9-18/h1-17,23-24,28H,(H,27,29)/t23-,24+/m0/s1 |
| InChIKey | BNLCPMPWXAQVHH-BJKOFHAPSA-N |
| XLogP | 5.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |