C17H19NO3S — CID 7962650
[(2R)-1-anilino-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate (PubChem CID 7962650) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is [(2R)-1-anilino-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-anilino-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7962650 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(2R)-1-anilino-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate |
| SMILES | C[C@@H](OC(=O)CCCc1cccs1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H19NO3S/c1-13(17(20)18-14-7-3-2-4-8-14)21-16(19)11-5-9-15-10-6-12-22-15/h2-4,6-8,10,12-13H,5,9,11H2,1H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | YXRSAFFDXGYECJ-CYBMUJFWSA-N |
| XLogP | 3.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |