C16H17ClN2O3S — CID 7962712
[(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate (PubChem CID 7962712) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7962712 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-thiophen-2-ylbutanoate |
| SMILES | C[C@@H](OC(=O)CCCc1cccs1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-11(16(21)19-14-8-7-12(17)10-18-14)22-15(20)6-2-4-13-5-3-9-23-13/h3,5,7-11H,2,4,6H2,1H3,(H,18,19,21)/t11-/m1/s1 |
| InChIKey | CRIIISNFNRURKX-LLVKDONJSA-N |
| XLogP | 3.69 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |