C19H23ClN4O5 — CID 8671746
[(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate (PubChem CID 8671746) has the molecular formula C19H23ClN4O5 and a molecular weight of 422.87 g/mol. Its IUPAC name is [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate.
| Compound Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
|---|---|
| PubChem CID | 8671746 |
| Molecular Formula | C19H23ClN4O5 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [(2R)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
| SMILES | C[C@@H](OC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C19H23ClN4O5/c1-12(16(26)22-14-7-6-13(20)11-21-14)29-15(25)5-4-10-24-17(27)19(23-18(24)28)8-2-3-9-19/h6-7,11-12H,2-5,8-10H2,1H3,(H,23,28)(H,21,22,26)/t12-/m1/s1 |
| InChIKey | CGQQNWWZSXLCNZ-GFCCVEGCSA-N |
| XLogP | 2.25 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|