C25H33F3NO6P — CID 88640269
1-amino-1-dibutoxyphosphoryl-3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]butan-2-one (PubChem CID 88640269) has the molecular formula C25H33F3NO6P and a molecular weight of 531.51 g/mol. Its IUPAC name is 1-amino-1-dibutoxyphosphoryl-3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]butan-2-one.
| Compound Name | 1-amino-1-dibutoxyphosphoryl-3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]butan-2-one |
|---|---|
| PubChem CID | 88640269 |
| Molecular Formula | C25H33F3NO6P |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 1-amino-1-dibutoxyphosphoryl-3-[4-[4-(trifluoromethyl)phenoxy]phenoxy]butan-2-one |
| SMILES | CCCCOP(=O)(OCCCC)C(N)C(=O)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H33F3NO6P/c1-4-6-16-32-36(31,33-17-7-5-2)24(29)23(30)18(3)34-20-12-14-22(15-13-20)35-21-10-8-19(9-11-21)25(26,27)28/h8-15,18,24H,4-7,16-17,29H2,1-3H3 |
| InChIKey | FFGZYBCRUQSVAV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|