C24H28F3O6P — CID 161409533
3-diethylphosphoryloxy-2-ethyl-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pent-2-enoic acid (PubChem CID 161409533) has the molecular formula C24H28F3O6P and a molecular weight of 500.45 g/mol. Its IUPAC name is 3-diethylphosphoryloxy-2-ethyl-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pent-2-enoic acid.
| Compound Name | 3-diethylphosphoryloxy-2-ethyl-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 161409533 |
| Molecular Formula | C24H28F3O6P |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 3-diethylphosphoryloxy-2-ethyl-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pent-2-enoic acid |
| SMILES | CCC(C(=O)O)=C(OP(=O)(CC)CC)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H28F3O6P/c1-5-21(23(28)29)22(33-34(30,6-2)7-3)16(4)31-18-12-14-20(15-13-18)32-19-10-8-17(9-11-19)24(25,26)27/h8-16H,5-7H2,1-4H3,(H,28,29) |
| InChIKey | KOYIRNYLQWJLRH-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|