C20H17F7O4 — CID 4263643
butyl 2-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoate (PubChem CID 4263643) has the molecular formula C20H17F7O4 and a molecular weight of 454.34 g/mol. Its IUPAC name is butyl 2-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoate.
| Compound Name | butyl 2-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 4263643 |
| Molecular Formula | C20H17F7O4 |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | butyl 2-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoate |
| SMILES | CCCCOC(=O)C(C)Oc1ccc(Oc2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H17F7O4/c1-3-4-9-29-19(28)10(2)30-11-5-7-12(8-6-11)31-18-16(23)14(21)13(20(25,26)27)15(22)17(18)24/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | PXCHNNBTCPVBQK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|