C44H48N2O6 — CID 101452909
2-(4-octoxyphenyl)-5-[2-(4-octoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione (PubChem CID 101452909) has the molecular formula C44H48N2O6 and a molecular weight of 700.88 g/mol. Its IUPAC name is 2-(4-octoxyphenyl)-5-[2-(4-octoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione.
| Compound Name | 2-(4-octoxyphenyl)-5-[2-(4-octoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101452909 |
| Molecular Formula | C44H48N2O6 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | 2-(4-octoxyphenyl)-5-[2-(4-octoxyphenyl)-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
| SMILES | CCCCCCCCOc1ccc(N2C(=O)c3ccc(-c4ccc5c(c4)C(=O)N(c4ccc(OCCCCCCCC)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C44H48N2O6/c1-3-5-7-9-11-13-27-51-35-21-17-33(18-22-35)45-41(47)37-25-15-31(29-39(37)43(45)49)32-16-26-38-40(30-32)44(50)46(42(38)48)34-19-23-36(24-20-34)52-28-14-12-10-8-6-4-2/h15-26,29-30H,3-14,27-28H2,1-2H3 |
| InChIKey | JENBHXRNOZIFNT-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|