C10H11N3O4 — CID 90261032
4-[4-(2-hydroxyethoxy)phenyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 90261032) has the molecular formula C10H11N3O4 and a molecular weight of 237.22 g/mol. Its IUPAC name is 4-[4-(2-hydroxyethoxy)phenyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[4-(2-hydroxyethoxy)phenyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 90261032 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-[4-(2-hydroxyethoxy)phenyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1-c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C10H11N3O4/c14-5-6-17-8-3-1-7(2-4-8)13-9(15)11-12-10(13)16/h1-4,14H,5-6H2,(H,11,15)(H,12,16) |
| InChIKey | CBIXRKLZJGLWEJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |