C9H8N4O2S — CID 107409646
4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzenecarbothioamide (PubChem CID 107409646) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzenecarbothioamide.
| Compound Name | 4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107409646 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-(3,5-dioxo-1,2,4-triazolidin-4-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(-n2c(=O)[nH][nH]c2=O)cc1 |
| InChI | InChI=1S/C9H8N4O2S/c10-7(16)5-1-3-6(4-2-5)13-8(14)11-12-9(13)15/h1-4H,(H2,10,16)(H,11,14)(H,12,15) |
| InChIKey | CSKJGYPUEYQLRL-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|